C18H22FN3 — CID 110954236
2-benzyl-1-ethyl-3-[2-(2-fluorophenyl)ethyl]guanidine (PubChem CID 110954236) has the molecular formula C18H22FN3 and a molecular weight of 299.39 g/mol. Its IUPAC name is 2-benzyl-1-ethyl-3-[2-(2-fluorophenyl)ethyl]guanidine.
| Compound Name | 2-benzyl-1-ethyl-3-[2-(2-fluorophenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 110954236 |
| Molecular Formula | C18H22FN3 |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | 2-benzyl-1-ethyl-3-[2-(2-fluorophenyl)ethyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccccc1)NCCc1ccccc1F |
| InChI | InChI=1S/C18H22FN3/c1-2-20-18(22-14-15-8-4-3-5-9-15)21-13-12-16-10-6-7-11-17(16)19/h3-11H,2,12-14H2,1H3,(H2,20,21,22) |
| InChIKey | BFNFYNIFSQXQPG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|