C17H22FN3S — CID 111361457
1-ethyl-3-[2-(2-fluorophenyl)ethyl]-2-[(5-methylthiophen-2-yl)methyl]guanidine (PubChem CID 111361457) has the molecular formula C17H22FN3S and a molecular weight of 319.45 g/mol. Its IUPAC name is 1-ethyl-3-[2-(2-fluorophenyl)ethyl]-2-[(5-methylthiophen-2-yl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(2-fluorophenyl)ethyl]-2-[(5-methylthiophen-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111361457 |
| Molecular Formula | C17H22FN3S |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 1-ethyl-3-[2-(2-fluorophenyl)ethyl]-2-[(5-methylthiophen-2-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(C)s1)NCCc1ccccc1F |
| InChI | InChI=1S/C17H22FN3S/c1-3-19-17(21-12-15-9-8-13(2)22-15)20-11-10-14-6-4-5-7-16(14)18/h4-9H,3,10-12H2,1-2H3,(H2,19,20,21) |
| InChIKey | JRDIIKNWRBHYLO-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|