C15H20FIN4O — CID 111965040
1-ethyl-3-[2-(2-fluorophenyl)ethyl]-2-(1,2-oxazol-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111965040) has the molecular formula C15H20FIN4O and a molecular weight of 418.25 g/mol. Its IUPAC name is 1-ethyl-3-[2-(2-fluorophenyl)ethyl]-2-(1,2-oxazol-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(2-fluorophenyl)ethyl]-2-(1,2-oxazol-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111965040 |
| Molecular Formula | C15H20FIN4O |
| Molecular Weight | 418.25 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | 1-ethyl-3-[2-(2-fluorophenyl)ethyl]-2-(1,2-oxazol-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccon1)NCCc1ccccc1F.I |
| InChI | InChI=1S/C15H19FN4O.HI/c1-2-17-15(19-11-13-8-10-21-20-13)18-9-7-12-5-3-4-6-14(12)16;/h3-6,8,10H,2,7,9,11H2,1H3,(H2,17,18,19);1H |
| InChIKey | SKZITCWDVVPMQN-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.25 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|