C12H22N4O — CID 111964181
1-ethyl-2-(1,2-oxazol-3-ylmethyl)-3-pentylguanidine (PubChem CID 111964181) has the molecular formula C12H22N4O and a molecular weight of 238.33 g/mol. Its IUPAC name is 1-ethyl-2-(1,2-oxazol-3-ylmethyl)-3-pentylguanidine.
| Compound Name | 1-ethyl-2-(1,2-oxazol-3-ylmethyl)-3-pentylguanidine |
|---|---|
| PubChem CID | 111964181 |
| Molecular Formula | C12H22N4O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | 1-ethyl-2-(1,2-oxazol-3-ylmethyl)-3-pentylguanidine |
| SMILES | CCCCCN/C(=N/Cc1ccon1)NCC |
| InChI | InChI=1S/C12H22N4O/c1-3-5-6-8-14-12(13-4-2)15-10-11-7-9-17-16-11/h7,9H,3-6,8,10H2,1-2H3,(H2,13,14,15) |
| InChIKey | ZQFVDERMGCCNDZ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|