C8H15N5O — CID 116516090
1-amino-2-(1,2-oxazol-3-ylmethyl)-3-propylguanidine (PubChem CID 116516090) has the molecular formula C8H15N5O and a molecular weight of 197.24 g/mol. Its IUPAC name is 1-amino-2-(1,2-oxazol-3-ylmethyl)-3-propylguanidine.
| Compound Name | 1-amino-2-(1,2-oxazol-3-ylmethyl)-3-propylguanidine |
|---|---|
| PubChem CID | 116516090 |
| Molecular Formula | C8H15N5O |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.13 |
| IUPAC Name | 1-amino-2-(1,2-oxazol-3-ylmethyl)-3-propylguanidine |
| SMILES | CCCN/C(=N\Cc1ccon1)NN |
| InChI | InChI=1S/C8H15N5O/c1-2-4-10-8(12-9)11-6-7-3-5-14-13-7/h3,5H,2,4,6,9H2,1H3,(H2,10,11,12) |
| InChIKey | BVZOKMZUBKPKBR-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 88.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|