C9H17N5O — CID 116513829
1-amino-2-[(5-methyl-1,2-oxazol-3-yl)methyl]-3-propylguanidine (PubChem CID 116513829) has the molecular formula C9H17N5O and a molecular weight of 211.27 g/mol. Its IUPAC name is 1-amino-2-[(5-methyl-1,2-oxazol-3-yl)methyl]-3-propylguanidine.
| Compound Name | 1-amino-2-[(5-methyl-1,2-oxazol-3-yl)methyl]-3-propylguanidine |
|---|---|
| PubChem CID | 116513829 |
| Molecular Formula | C9H17N5O |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | 1-amino-2-[(5-methyl-1,2-oxazol-3-yl)methyl]-3-propylguanidine |
| SMILES | CCCN/C(=N\Cc1cc(C)on1)NN |
| InChI | InChI=1S/C9H17N5O/c1-3-4-11-9(13-10)12-6-8-5-7(2)15-14-8/h5H,3-4,6,10H2,1-2H3,(H2,11,12,13) |
| InChIKey | BKBWYSMKUORCOX-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 88.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|