C17H22F2N4O — CID 97220760
1-[(2R)-2-(3,4-difluorophenyl)propyl]-3-ethyl-2-[(5-methyl-1,2-oxazol-3-yl)methyl]guanidine (PubChem CID 97220760) has the molecular formula C17H22F2N4O and a molecular weight of 336.39 g/mol. Its IUPAC name is 1-[(2R)-2-(3,4-difluorophenyl)propyl]-3-ethyl-2-[(5-methyl-1,2-oxazol-3-yl)methyl]guanidine.
| Compound Name | 1-[(2R)-2-(3,4-difluorophenyl)propyl]-3-ethyl-2-[(5-methyl-1,2-oxazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 97220760 |
| Molecular Formula | C17H22F2N4O |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 1-[(2R)-2-(3,4-difluorophenyl)propyl]-3-ethyl-2-[(5-methyl-1,2-oxazol-3-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cc(C)on1)NC[C@H](C)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H22F2N4O/c1-4-20-17(22-10-14-7-12(3)24-23-14)21-9-11(2)13-5-6-15(18)16(19)8-13/h5-8,11H,4,9-10H2,1-3H3,(H2,20,21,22)/t11-/m0/s1 |
| InChIKey | DPTGOPSDOWWCNY-NSHDSACASA-N |
| XLogP | 3.12 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|