C19H25F2IN4 — CID 111500304
2-[2-(3,4-difluorophenyl)propyl]-1-ethyl-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide (PubChem CID 111500304) has the molecular formula C19H25F2IN4 and a molecular weight of 474.34 g/mol. Its IUPAC name is 2-[2-(3,4-difluorophenyl)propyl]-1-ethyl-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-[2-(3,4-difluorophenyl)propyl]-1-ethyl-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111500304 |
| Molecular Formula | C19H25F2IN4 |
| Molecular Weight | 474.34 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | 2-[2-(3,4-difluorophenyl)propyl]-1-ethyl-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)c1ccc(F)c(F)c1)NCCc1ccccn1.I |
| InChI | InChI=1S/C19H24F2N4.HI/c1-3-22-19(24-11-9-16-6-4-5-10-23-16)25-13-14(2)15-7-8-17(20)18(21)12-15;/h4-8,10,12,14H,3,9,11,13H2,1-2H3,(H2,22,24,25);1H |
| InChIKey | DOMVDDYWVFOXJM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.34 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|