C18H25ClN4O2 — CID 111985475
1-[2-(4-chlorophenyl)-2-hydroxyethyl]-3-ethyl-2-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine (PubChem CID 111985475) has the molecular formula C18H25ClN4O2 and a molecular weight of 364.88 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)-2-hydroxyethyl]-3-ethyl-2-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine.
| Compound Name | 1-[2-(4-chlorophenyl)-2-hydroxyethyl]-3-ethyl-2-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111985475 |
| Molecular Formula | C18H25ClN4O2 |
| Molecular Weight | 364.88 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 1-[2-(4-chlorophenyl)-2-hydroxyethyl]-3-ethyl-2-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cc(C(C)C)no1)NCC(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H25ClN4O2/c1-4-20-18(21-10-15-9-16(12(2)3)23-25-15)22-11-17(24)13-5-7-14(19)8-6-13/h5-9,12,17,24H,4,10-11H2,1-3H3,(H2,20,21,22) |
| InChIKey | DDKLJAHFSZAMAS-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.88 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|