C18H28F2N4 — CID 75424225
2-[2-(3,4-difluorophenyl)propyl]-1-ethyl-3-[(1-methylpyrrolidin-3-yl)methyl]guanidine (PubChem CID 75424225) has the molecular formula C18H28F2N4 and a molecular weight of 338.45 g/mol. Its IUPAC name is 2-[2-(3,4-difluorophenyl)propyl]-1-ethyl-3-[(1-methylpyrrolidin-3-yl)methyl]guanidine.
| Compound Name | 2-[2-(3,4-difluorophenyl)propyl]-1-ethyl-3-[(1-methylpyrrolidin-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 75424225 |
| Molecular Formula | C18H28F2N4 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | 2-[2-(3,4-difluorophenyl)propyl]-1-ethyl-3-[(1-methylpyrrolidin-3-yl)methyl]guanidine |
| SMILES | CCN/C(=N\CC(C)c1ccc(F)c(F)c1)NCC1CCN(C)C1 |
| InChI | InChI=1S/C18H28F2N4/c1-4-21-18(23-11-14-7-8-24(3)12-14)22-10-13(2)15-5-6-16(19)17(20)9-15/h5-6,9,13-14H,4,7-8,10-12H2,1-3H3,(H2,21,22,23) |
| InChIKey | NDWVMTDZPANZTF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|