C17H26F2IN3O — CID 111500954
N'-[2-(3,4-difluorophenyl)propyl]-N-ethyl-4-hydroxypiperidine-1-carboximidamide;hydroiodide (PubChem CID 111500954) has the molecular formula C17H26F2IN3O and a molecular weight of 453.32 g/mol. Its IUPAC name is N'-[2-(3,4-difluorophenyl)propyl]-N-ethyl-4-hydroxypiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[2-(3,4-difluorophenyl)propyl]-N-ethyl-4-hydroxypiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111500954 |
| Molecular Formula | C17H26F2IN3O |
| Molecular Weight | 453.32 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | N'-[2-(3,4-difluorophenyl)propyl]-N-ethyl-4-hydroxypiperidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC(C)c1ccc(F)c(F)c1)N1CCC(O)CC1.I |
| InChI | InChI=1S/C17H25F2N3O.HI/c1-3-20-17(22-8-6-14(23)7-9-22)21-11-12(2)13-4-5-15(18)16(19)10-13;/h4-5,10,12,14,23H,3,6-9,11H2,1-2H3,(H,20,21);1H |
| InChIKey | MEVSQJCHGZTYDE-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|