C19H28F2IN3O2 — CID 111500120
ethyl 1-[N-[2-(3,4-difluorophenyl)propyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111500120) has the molecular formula C19H28F2IN3O2 and a molecular weight of 495.35 g/mol. Its IUPAC name is ethyl 1-[N-[2-(3,4-difluorophenyl)propyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | ethyl 1-[N-[2-(3,4-difluorophenyl)propyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111500120 |
| Molecular Formula | C19H28F2IN3O2 |
| Molecular Weight | 495.35 g/mol |
| Exact Mass | 495.12 |
| IUPAC Name | ethyl 1-[N-[2-(3,4-difluorophenyl)propyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | CCOC(=O)C1CCN(/C(=N/C)NCC(C)c2ccc(F)c(F)c2)CC1.I |
| InChI | InChI=1S/C19H27F2N3O2.HI/c1-4-26-18(25)14-7-9-24(10-8-14)19(22-3)23-12-13(2)15-5-6-16(20)17(21)11-15;/h5-6,11,13-14H,4,7-10,12H2,1-3H3,(H,22,23);1H |
| InChIKey | QOQBTFIEGOMEOQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|