C17H24BrFIN3O2 — CID 111977314
ethyl 1-[N-[(4-bromo-2-fluorophenyl)methyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111977314) has the molecular formula C17H24BrFIN3O2 and a molecular weight of 528.20 g/mol. Its IUPAC name is ethyl 1-[N-[(4-bromo-2-fluorophenyl)methyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | ethyl 1-[N-[(4-bromo-2-fluorophenyl)methyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111977314 |
| Molecular Formula | C17H24BrFIN3O2 |
| Molecular Weight | 528.20 g/mol |
| Exact Mass | 527.01 |
| IUPAC Name | ethyl 1-[N-[(4-bromo-2-fluorophenyl)methyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | CCOC(=O)C1CCN(/C(=N/C)NCc2ccc(Br)cc2F)CC1.I |
| InChI | InChI=1S/C17H23BrFN3O2.HI/c1-3-24-16(23)12-6-8-22(9-7-12)17(20-2)21-11-13-4-5-14(18)10-15(13)19;/h4-5,10,12H,3,6-9,11H2,1-2H3,(H,20,21);1H |
| InChIKey | FBBMRTAJYFWLHR-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.20 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|