C18H26BrN3O3 — CID 111157931
ethyl 1-[N-[2-(4-bromophenoxy)ethyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate (PubChem CID 111157931) has the molecular formula C18H26BrN3O3 and a molecular weight of 412.33 g/mol. Its IUPAC name is ethyl 1-[N-[2-(4-bromophenoxy)ethyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[N-[2-(4-bromophenoxy)ethyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 111157931 |
| Molecular Formula | C18H26BrN3O3 |
| Molecular Weight | 412.33 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | ethyl 1-[N-[2-(4-bromophenoxy)ethyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(/C(=N/C)NCCOc2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C18H26BrN3O3/c1-3-24-17(23)14-8-11-22(12-9-14)18(20-2)21-10-13-25-16-6-4-15(19)5-7-16/h4-7,14H,3,8-13H2,1-2H3,(H,20,21) |
| InChIKey | FVAJCQXCRCUGNP-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.33 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|