C19H26F3N3O3 — CID 111155056
ethyl 1-[N'-methyl-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]carbamimidoyl]piperidine-4-carboxylate (PubChem CID 111155056) has the molecular formula C19H26F3N3O3 and a molecular weight of 401.43 g/mol. Its IUPAC name is ethyl 1-[N'-methyl-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]carbamimidoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[N'-methyl-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]carbamimidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 111155056 |
| Molecular Formula | C19H26F3N3O3 |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | ethyl 1-[N'-methyl-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]carbamimidoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(/C(=N/C)NCCOc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C19H26F3N3O3/c1-3-27-17(26)14-7-10-25(11-8-14)18(23-2)24-9-12-28-16-6-4-5-15(13-16)19(20,21)22/h4-6,13-14H,3,7-12H2,1-2H3,(H,23,24) |
| InChIKey | ZQYRBJLOSXHIJG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|