C18H26F3N5O2 — CID 111156381
ethyl 1-[N'-methyl-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]carbamimidoyl]piperidine-4-carboxylate (PubChem CID 111156381) has the molecular formula C18H26F3N5O2 and a molecular weight of 401.43 g/mol. Its IUPAC name is ethyl 1-[N'-methyl-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]carbamimidoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[N'-methyl-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]carbamimidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 111156381 |
| Molecular Formula | C18H26F3N5O2 |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | ethyl 1-[N'-methyl-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]carbamimidoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(/C(=N\C)NCCNc2ncccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C18H26F3N5O2/c1-3-28-16(27)13-6-11-26(12-7-13)17(22-2)25-10-9-24-15-14(18(19,20)21)5-4-8-23-15/h4-5,8,13H,3,6-7,9-12H2,1-2H3,(H,22,25)(H,23,24) |
| InChIKey | ALUKWOVLHNXKIH-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|