C20H27F3N4O3 — CID 111155284
ethyl 1-[N'-methyl-N-[2-[[4-(trifluoromethyl)benzoyl]amino]ethyl]carbamimidoyl]piperidine-4-carboxylate (PubChem CID 111155284) has the molecular formula C20H27F3N4O3 and a molecular weight of 428.46 g/mol. Its IUPAC name is ethyl 1-[N'-methyl-N-[2-[[4-(trifluoromethyl)benzoyl]amino]ethyl]carbamimidoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[N'-methyl-N-[2-[[4-(trifluoromethyl)benzoyl]amino]ethyl]carbamimidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 111155284 |
| Molecular Formula | C20H27F3N4O3 |
| Molecular Weight | 428.46 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | ethyl 1-[N'-methyl-N-[2-[[4-(trifluoromethyl)benzoyl]amino]ethyl]carbamimidoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(/C(=N\C)NCCNC(=O)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C20H27F3N4O3/c1-3-30-18(29)15-8-12-27(13-9-15)19(24-2)26-11-10-25-17(28)14-4-6-16(7-5-14)20(21,22)23/h4-7,15H,3,8-13H2,1-2H3,(H,24,26)(H,25,28) |
| InChIKey | NGFKMYKMAFNHIS-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.46 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|