C21H30F3IN4O3 — CID 111154859
ethyl 1-[N-ethyl-N'-[2-[[4-(trifluoromethyl)benzoyl]amino]ethyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111154859) has the molecular formula C21H30F3IN4O3 and a molecular weight of 570.39 g/mol. Its IUPAC name is ethyl 1-[N-ethyl-N'-[2-[[4-(trifluoromethyl)benzoyl]amino]ethyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | ethyl 1-[N-ethyl-N'-[2-[[4-(trifluoromethyl)benzoyl]amino]ethyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111154859 |
| Molecular Formula | C21H30F3IN4O3 |
| Molecular Weight | 570.39 g/mol |
| Exact Mass | 570.13 |
| IUPAC Name | ethyl 1-[N-ethyl-N'-[2-[[4-(trifluoromethyl)benzoyl]amino]ethyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CCNC(=O)c1ccc(C(F)(F)F)cc1)N1CCC(C(=O)OCC)CC1.I |
| InChI | InChI=1S/C21H29F3N4O3.HI/c1-3-25-20(28-13-9-16(10-14-28)19(30)31-4-2)27-12-11-26-18(29)15-5-7-17(8-6-15)21(22,23)24;/h5-8,16H,3-4,9-14H2,1-2H3,(H,25,27)(H,26,29);1H |
| InChIKey | PCPABXIHKRGOET-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.39 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|