C21H27F3IN7O — CID 111205545
N-[2-[[ethylamino-(4-pyrimidin-2-ylpiperazin-1-yl)methylidene]amino]ethyl]-4-(trifluoromethyl)benzamide;hydroiodide (PubChem CID 111205545) has the molecular formula C21H27F3IN7O and a molecular weight of 577.39 g/mol. Its IUPAC name is N-[2-[[ethylamino-(4-pyrimidin-2-ylpiperazin-1-yl)methylidene]amino]ethyl]-4-(trifluoromethyl)benzamide;hydroiodide.
| Compound Name | N-[2-[[ethylamino-(4-pyrimidin-2-ylpiperazin-1-yl)methylidene]amino]ethyl]-4-(trifluoromethyl)benzamide;hydroiodide |
|---|---|
| PubChem CID | 111205545 |
| Molecular Formula | C21H27F3IN7O |
| Molecular Weight | 577.39 g/mol |
| Exact Mass | 577.13 |
| IUPAC Name | N-[2-[[ethylamino-(4-pyrimidin-2-ylpiperazin-1-yl)methylidene]amino]ethyl]-4-(trifluoromethyl)benzamide;hydroiodide |
| SMILES | CCN/C(=N\CCNC(=O)c1ccc(C(F)(F)F)cc1)N1CCN(c2ncccn2)CC1.I |
| InChI | InChI=1S/C21H26F3N7O.HI/c1-2-25-19(30-12-14-31(15-13-30)20-27-8-3-9-28-20)29-11-10-26-18(32)16-4-6-17(7-5-16)21(22,23)24;/h3-9H,2,10-15H2,1H3,(H,25,29)(H,26,32);1H |
| InChIKey | BUAVNHCWGUTFBE-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|