C15H25IN6O2 — CID 111207595
methyl 3-[[ethylamino-(4-pyrimidin-2-ylpiperazin-1-yl)methylidene]amino]propanoate;hydroiodide (PubChem CID 111207595) has the molecular formula C15H25IN6O2 and a molecular weight of 448.31 g/mol. Its IUPAC name is methyl 3-[[ethylamino-(4-pyrimidin-2-ylpiperazin-1-yl)methylidene]amino]propanoate;hydroiodide.
| Compound Name | methyl 3-[[ethylamino-(4-pyrimidin-2-ylpiperazin-1-yl)methylidene]amino]propanoate;hydroiodide |
|---|---|
| PubChem CID | 111207595 |
| Molecular Formula | C15H25IN6O2 |
| Molecular Weight | 448.31 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | methyl 3-[[ethylamino-(4-pyrimidin-2-ylpiperazin-1-yl)methylidene]amino]propanoate;hydroiodide |
| SMILES | CCN/C(=N\CCC(=O)OC)N1CCN(c2ncccn2)CC1.I |
| InChI | InChI=1S/C15H24N6O2.HI/c1-3-16-14(19-8-5-13(22)23-2)20-9-11-21(12-10-20)15-17-6-4-7-18-15;/h4,6-7H,3,5,8-12H2,1-2H3,(H,16,19);1H |
| InChIKey | XKNCUBBAVYZLMC-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.31 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|