C17H30N6 — CID 111207964
N-ethyl-N'-hexyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide (PubChem CID 111207964) has the molecular formula C17H30N6 and a molecular weight of 318.47 g/mol. Its IUPAC name is N-ethyl-N'-hexyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-hexyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111207964 |
| Molecular Formula | C17H30N6 |
| Molecular Weight | 318.47 g/mol |
| Exact Mass | 318.25 |
| IUPAC Name | N-ethyl-N'-hexyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
| SMILES | CCCCCC/N=C(\NCC)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C17H30N6/c1-3-5-6-7-9-19-16(18-4-2)22-12-14-23(15-13-22)17-20-10-8-11-21-17/h8,10-11H,3-7,9,12-15H2,1-2H3,(H,18,19) |
| InChIKey | CMPGRROZDAKFKD-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.47 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|