C18H29N7O — CID 111205126
N-ethyl-N'-[3-(2-oxopyrrolidin-1-yl)propyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide (PubChem CID 111205126) has the molecular formula C18H29N7O and a molecular weight of 359.48 g/mol. Its IUPAC name is N-ethyl-N'-[3-(2-oxopyrrolidin-1-yl)propyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[3-(2-oxopyrrolidin-1-yl)propyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111205126 |
| Molecular Formula | C18H29N7O |
| Molecular Weight | 359.48 g/mol |
| Exact Mass | 359.24 |
| IUPAC Name | N-ethyl-N'-[3-(2-oxopyrrolidin-1-yl)propyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCN1CCCC1=O)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C18H29N7O/c1-2-19-17(22-9-5-11-23-10-3-6-16(23)26)24-12-14-25(15-13-24)18-20-7-4-8-21-18/h4,7-8H,2-3,5-6,9-15H2,1H3,(H,19,22) |
| InChIKey | WHUPGIOBGBQHCZ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.48 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|