C20H33N7O — CID 111208028
N-ethyl-N'-[3-(2-oxoazepan-1-yl)propyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide (PubChem CID 111208028) has the molecular formula C20H33N7O and a molecular weight of 387.53 g/mol. Its IUPAC name is N-ethyl-N'-[3-(2-oxoazepan-1-yl)propyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[3-(2-oxoazepan-1-yl)propyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111208028 |
| Molecular Formula | C20H33N7O |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.27 |
| IUPAC Name | N-ethyl-N'-[3-(2-oxoazepan-1-yl)propyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCN1CCCCCC1=O)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C20H33N7O/c1-2-21-19(24-11-7-13-25-12-5-3-4-8-18(25)28)26-14-16-27(17-15-26)20-22-9-6-10-23-20/h6,9-10H,2-5,7-8,11-17H2,1H3,(H,21,24) |
| InChIKey | GBJMYMZOEMBWLP-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|