C23H41IN8O — CID 111347609
1-ethyl-2-[3-(2-oxoazepan-1-yl)propyl]-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide (PubChem CID 111347609) has the molecular formula C23H41IN8O and a molecular weight of 572.54 g/mol. Its IUPAC name is 1-ethyl-2-[3-(2-oxoazepan-1-yl)propyl]-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[3-(2-oxoazepan-1-yl)propyl]-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111347609 |
| Molecular Formula | C23H41IN8O |
| Molecular Weight | 572.54 g/mol |
| Exact Mass | 572.24 |
| IUPAC Name | 1-ethyl-2-[3-(2-oxoazepan-1-yl)propyl]-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCN1CCCCCC1=O)NCCCN1CCN(c2ncccn2)CC1.I |
| InChI | InChI=1S/C23H40N8O.HI/c1-2-24-22(26-13-8-16-30-15-5-3-4-9-21(30)32)25-12-7-14-29-17-19-31(20-18-29)23-27-10-6-11-28-23;/h6,10-11H,2-5,7-9,12-20H2,1H3,(H2,24,25,26);1H |
| InChIKey | KHGFJGAFRGVBMR-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 88.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.54 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|