C23H42IN7O — CID 111396851
2-(3-cyclohexyloxypropyl)-1-ethyl-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide (PubChem CID 111396851) has the molecular formula C23H42IN7O and a molecular weight of 559.54 g/mol. Its IUPAC name is 2-(3-cyclohexyloxypropyl)-1-ethyl-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 2-(3-cyclohexyloxypropyl)-1-ethyl-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111396851 |
| Molecular Formula | C23H42IN7O |
| Molecular Weight | 559.54 g/mol |
| Exact Mass | 559.25 |
| IUPAC Name | 2-(3-cyclohexyloxypropyl)-1-ethyl-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCOC1CCCCC1)NCCCN1CCN(c2ncccn2)CC1.I |
| InChI | InChI=1S/C23H41N7O.HI/c1-2-24-22(26-14-8-20-31-21-9-4-3-5-10-21)25-13-7-15-29-16-18-30(19-17-29)23-27-11-6-12-28-23;/h6,11-12,21H,2-5,7-10,13-20H2,1H3,(H2,24,25,26);1H |
| InChIKey | VZSWLGCVUCYXLF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 77.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.54 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|