C22H40IN7O — CID 111576356
1-(2-cycloheptyloxyethyl)-2-methyl-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide (PubChem CID 111576356) has the molecular formula C22H40IN7O and a molecular weight of 545.51 g/mol. Its IUPAC name is 1-(2-cycloheptyloxyethyl)-2-methyl-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-(2-cycloheptyloxyethyl)-2-methyl-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111576356 |
| Molecular Formula | C22H40IN7O |
| Molecular Weight | 545.51 g/mol |
| Exact Mass | 545.23 |
| IUPAC Name | 1-(2-cycloheptyloxyethyl)-2-methyl-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCN1CCN(c2ncccn2)CC1)NCCOC1CCCCCC1.I |
| InChI | InChI=1S/C22H39N7O.HI/c1-23-21(25-13-19-30-20-8-4-2-3-5-9-20)24-12-7-14-28-15-17-29(18-16-28)22-26-10-6-11-27-22;/h6,10-11,20H,2-5,7-9,12-19H2,1H3,(H2,23,24,25);1H |
| InChIKey | KDYMSAJQSRPFOW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 77.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.51 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|