C20H36IN7O2 — CID 111408458
2-methyl-1-[3-(oxolan-2-ylmethoxy)propyl]-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine;hydroiodide (PubChem CID 111408458) has the molecular formula C20H36IN7O2 and a molecular weight of 533.46 g/mol. Its IUPAC name is 2-methyl-1-[3-(oxolan-2-ylmethoxy)propyl]-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[3-(oxolan-2-ylmethoxy)propyl]-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111408458 |
| Molecular Formula | C20H36IN7O2 |
| Molecular Weight | 533.46 g/mol |
| Exact Mass | 533.20 |
| IUPAC Name | 2-methyl-1-[3-(oxolan-2-ylmethoxy)propyl]-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCOCC1CCCO1)NCCN1CCN(c2ncccn2)CC1.I |
| InChI | InChI=1S/C20H35N7O2.HI/c1-21-19(22-8-4-15-28-17-18-5-2-16-29-18)23-9-10-26-11-13-27(14-12-26)20-24-6-3-7-25-20;/h3,6-7,18H,2,4-5,8-17H2,1H3,(H2,21,22,23);1H |
| InChIKey | HWZLFHDJCZYJBE-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.46 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|