C24H41N5O3 — CID 111407733
1-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-2-methyl-3-[3-(oxolan-2-ylmethoxy)propyl]guanidine (PubChem CID 111407733) has the molecular formula C24H41N5O3 and a molecular weight of 447.62 g/mol. Its IUPAC name is 1-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-2-methyl-3-[3-(oxolan-2-ylmethoxy)propyl]guanidine.
| Compound Name | 1-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-2-methyl-3-[3-(oxolan-2-ylmethoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111407733 |
| Molecular Formula | C24H41N5O3 |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.32 |
| IUPAC Name | 1-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-2-methyl-3-[3-(oxolan-2-ylmethoxy)propyl]guanidine |
| SMILES | C/N=C(\NCCCOCC1CCCO1)NCCCN1CCN(c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C24H41N5O3/c1-25-24(27-12-5-18-31-20-23-6-3-19-32-23)26-11-4-13-28-14-16-29(17-15-28)21-7-9-22(30-2)10-8-21/h7-10,23H,3-6,11-20H2,1-2H3,(H2,25,26,27) |
| InChIKey | WNRQSBRELBJFBB-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|