C23H38FN5O2 — CID 111409489
1-ethyl-3-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-2-[3-(oxolan-2-ylmethoxy)propyl]guanidine (PubChem CID 111409489) has the molecular formula C23H38FN5O2 and a molecular weight of 435.59 g/mol. Its IUPAC name is 1-ethyl-3-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-2-[3-(oxolan-2-ylmethoxy)propyl]guanidine.
| Compound Name | 1-ethyl-3-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-2-[3-(oxolan-2-ylmethoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111409489 |
| Molecular Formula | C23H38FN5O2 |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.30 |
| IUPAC Name | 1-ethyl-3-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-2-[3-(oxolan-2-ylmethoxy)propyl]guanidine |
| SMILES | CCN/C(=N\CCCOCC1CCCO1)NCCN1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C23H38FN5O2/c1-2-25-23(26-10-4-17-30-19-22-5-3-18-31-22)27-11-12-28-13-15-29(16-14-28)21-8-6-20(24)7-9-21/h6-9,22H,2-5,10-19H2,1H3,(H2,25,26,27) |
| InChIKey | XUEQJYBZHRKPKT-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|