C20H35N7O2 — CID 111648364
2-methyl-1-[3-(oxolan-3-ylmethoxy)propyl]-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine (PubChem CID 111648364) has the molecular formula C20H35N7O2 and a molecular weight of 405.55 g/mol. Its IUPAC name is 2-methyl-1-[3-(oxolan-3-ylmethoxy)propyl]-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine.
| Compound Name | 2-methyl-1-[3-(oxolan-3-ylmethoxy)propyl]-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111648364 |
| Molecular Formula | C20H35N7O2 |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.29 |
| IUPAC Name | 2-methyl-1-[3-(oxolan-3-ylmethoxy)propyl]-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine |
| SMILES | C/N=C(\NCCCOCC1CCOC1)NCCN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C20H35N7O2/c1-21-19(22-7-3-14-28-16-18-4-15-29-17-18)23-8-9-26-10-12-27(13-11-26)20-24-5-2-6-25-20/h2,5-6,18H,3-4,7-17H2,1H3,(H2,21,22,23) |
| InChIKey | GLQKLLNTZGRWLV-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|