C20H37N7 — CID 111580346
2-methyl-1-(5-methylhexyl)-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine (PubChem CID 111580346) has the molecular formula C20H37N7 and a molecular weight of 375.57 g/mol. Its IUPAC name is 2-methyl-1-(5-methylhexyl)-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine.
| Compound Name | 2-methyl-1-(5-methylhexyl)-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111580346 |
| Molecular Formula | C20H37N7 |
| Molecular Weight | 375.57 g/mol |
| Exact Mass | 375.31 |
| IUPAC Name | 2-methyl-1-(5-methylhexyl)-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine |
| SMILES | C/N=C(\NCCCCC(C)C)NCCCN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C20H37N7/c1-18(2)8-4-5-9-22-19(21-3)23-12-7-13-26-14-16-27(17-15-26)20-24-10-6-11-25-20/h6,10-11,18H,4-5,7-9,12-17H2,1-3H3,(H2,21,22,23) |
| InChIKey | DGHNRVHMGVZAHX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.57 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|