C20H33IN8O — CID 111587246
2-methyl-1-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide (PubChem CID 111587246) has the molecular formula C20H33IN8O and a molecular weight of 528.44 g/mol. Its IUPAC name is 2-methyl-1-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111587246 |
| Molecular Formula | C20H33IN8O |
| Molecular Weight | 528.44 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | 2-methyl-1-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCN1CCN(c2ncccn2)CC1)NCc1cc(C(C)C)no1.I |
| InChI | InChI=1S/C20H32N8O.HI/c1-16(2)18-14-17(29-26-18)15-25-19(21-3)22-8-5-9-27-10-12-28(13-11-27)20-23-6-4-7-24-20;/h4,6-7,14,16H,5,8-13,15H2,1-3H3,(H2,21,22,25);1H |
| InChIKey | NLMGLJSYTUGLHO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 94.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.44 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|