C18H33N7S — CID 111629150
2-methyl-1-(4-methylsulfanylbutyl)-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine (PubChem CID 111629150) has the molecular formula C18H33N7S and a molecular weight of 379.58 g/mol. Its IUPAC name is 2-methyl-1-(4-methylsulfanylbutyl)-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine.
| Compound Name | 2-methyl-1-(4-methylsulfanylbutyl)-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111629150 |
| Molecular Formula | C18H33N7S |
| Molecular Weight | 379.58 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | 2-methyl-1-(4-methylsulfanylbutyl)-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine |
| SMILES | C/N=C(\NCCCCSC)NCCCN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C18H33N7S/c1-19-17(20-7-3-4-16-26-2)21-10-6-11-24-12-14-25(15-13-24)18-22-8-5-9-23-18/h5,8-9H,3-4,6-7,10-16H2,1-2H3,(H2,19,20,21) |
| InChIKey | IUCHHFJCZHMEIQ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.58 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|