C20H38IN7O — CID 111710300
1-(2-methoxy-3,3-dimethylbutyl)-2-methyl-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide (PubChem CID 111710300) has the molecular formula C20H38IN7O and a molecular weight of 519.48 g/mol. Its IUPAC name is 1-(2-methoxy-3,3-dimethylbutyl)-2-methyl-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-(2-methoxy-3,3-dimethylbutyl)-2-methyl-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111710300 |
| Molecular Formula | C20H38IN7O |
| Molecular Weight | 519.48 g/mol |
| Exact Mass | 519.22 |
| IUPAC Name | 1-(2-methoxy-3,3-dimethylbutyl)-2-methyl-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCN1CCN(c2ncccn2)CC1)NCC(OC)C(C)(C)C.I |
| InChI | InChI=1S/C20H37N7O.HI/c1-20(2,3)17(28-5)16-25-18(21-4)22-10-7-11-26-12-14-27(15-13-26)19-23-8-6-9-24-19;/h6,8-9,17H,7,10-16H2,1-5H3,(H2,21,22,25);1H |
| InChIKey | MSYCPSBGOKIJKE-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 77.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.48 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|