C17H31N7 — CID 110977851
2-methyl-1-(3-methylbutyl)-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine (PubChem CID 110977851) has the molecular formula C17H31N7 and a molecular weight of 333.48 g/mol. Its IUPAC name is 2-methyl-1-(3-methylbutyl)-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine.
| Compound Name | 2-methyl-1-(3-methylbutyl)-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 110977851 |
| Molecular Formula | C17H31N7 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.26 |
| IUPAC Name | 2-methyl-1-(3-methylbutyl)-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine |
| SMILES | C/N=C(\NCCC(C)C)NCCN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C17H31N7/c1-15(2)5-8-19-16(18-3)20-9-10-23-11-13-24(14-12-23)17-21-6-4-7-22-17/h4,6-7,15H,5,8-14H2,1-3H3,(H2,18,19,20) |
| InChIKey | QLIBWMQQARMUOC-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|