C16H30IN7O — CID 111237368
1-(1-methoxypropan-2-yl)-2-methyl-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine;hydroiodide (PubChem CID 111237368) has the molecular formula C16H30IN7O and a molecular weight of 463.37 g/mol. Its IUPAC name is 1-(1-methoxypropan-2-yl)-2-methyl-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-(1-methoxypropan-2-yl)-2-methyl-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111237368 |
| Molecular Formula | C16H30IN7O |
| Molecular Weight | 463.37 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | 1-(1-methoxypropan-2-yl)-2-methyl-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCN1CCN(c2ncccn2)CC1)NC(C)COC.I |
| InChI | InChI=1S/C16H29N7O.HI/c1-14(13-24-3)21-15(17-2)18-7-8-22-9-11-23(12-10-22)16-19-5-4-6-20-16;/h4-6,14H,7-13H2,1-3H3,(H2,17,18,21);1H |
| InChIKey | UDGZYFPAIFCWPX-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 77.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.37 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|