C15H26IN7 — CID 110980986
2-methyl-1-prop-2-enyl-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine;hydroiodide (PubChem CID 110980986) has the molecular formula C15H26IN7 and a molecular weight of 431.33 g/mol. Its IUPAC name is 2-methyl-1-prop-2-enyl-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-prop-2-enyl-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110980986 |
| Molecular Formula | C15H26IN7 |
| Molecular Weight | 431.33 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 2-methyl-1-prop-2-enyl-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine;hydroiodide |
| SMILES | C=CCN/C(=N\C)NCCN1CCN(c2ncccn2)CC1.I |
| InChI | InChI=1S/C15H25N7.HI/c1-3-5-17-14(16-2)18-8-9-21-10-12-22(13-11-21)15-19-6-4-7-20-15;/h3-4,6-7H,1,5,8-13H2,2H3,(H2,16,17,18);1H |
| InChIKey | KVTVKUNSIQHKRJ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.33 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|