C21H29F3IN7 — CID 111295854
2-methyl-1-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide (PubChem CID 111295854) has the molecular formula C21H29F3IN7 and a molecular weight of 563.41 g/mol. Its IUPAC name is 2-methyl-1-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111295854 |
| Molecular Formula | C21H29F3IN7 |
| Molecular Weight | 563.41 g/mol |
| Exact Mass | 563.15 |
| IUPAC Name | 2-methyl-1-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1ccc(C(F)(F)F)cc1)NCCN1CCN(c2ncccn2)CC1.I |
| InChI | InChI=1S/C21H28F3N7.HI/c1-25-19(26-10-7-17-3-5-18(6-4-17)21(22,23)24)27-11-12-30-13-15-31(16-14-30)20-28-8-2-9-29-20;/h2-6,8-9H,7,10-16H2,1H3,(H2,25,26,27);1H |
| InChIKey | NAVBLHUZBKUFDQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|