C21H30FN7O — CID 111684906
1-[2-(2-fluorophenoxy)propyl]-2-methyl-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine (PubChem CID 111684906) has the molecular formula C21H30FN7O and a molecular weight of 415.52 g/mol. Its IUPAC name is 1-[2-(2-fluorophenoxy)propyl]-2-methyl-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine.
| Compound Name | 1-[2-(2-fluorophenoxy)propyl]-2-methyl-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111684906 |
| Molecular Formula | C21H30FN7O |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | 1-[2-(2-fluorophenoxy)propyl]-2-methyl-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine |
| SMILES | C/N=C(/NCCN1CCN(c2ncccn2)CC1)NCC(C)Oc1ccccc1F |
| InChI | InChI=1S/C21H30FN7O/c1-17(30-19-7-4-3-6-18(19)22)16-27-20(23-2)24-10-11-28-12-14-29(15-13-28)21-25-8-5-9-26-21/h3-9,17H,10-16H2,1-2H3,(H2,23,24,27) |
| InChIKey | XUVBDYNUPRVKQM-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 77.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|