C22H32FN7O — CID 111684528
1-ethyl-2-[2-(2-fluorophenoxy)propyl]-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine (PubChem CID 111684528) has the molecular formula C22H32FN7O and a molecular weight of 429.54 g/mol. Its IUPAC name is 1-ethyl-2-[2-(2-fluorophenoxy)propyl]-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine.
| Compound Name | 1-ethyl-2-[2-(2-fluorophenoxy)propyl]-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111684528 |
| Molecular Formula | C22H32FN7O |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.27 |
| IUPAC Name | 1-ethyl-2-[2-(2-fluorophenoxy)propyl]-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\CC(C)Oc1ccccc1F)NCCN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C22H32FN7O/c1-3-24-21(28-17-18(2)31-20-8-5-4-7-19(20)23)25-11-12-29-13-15-30(16-14-29)22-26-9-6-10-27-22/h4-10,18H,3,11-17H2,1-2H3,(H2,24,25,28) |
| InChIKey | PSBMGGFWRCUQFX-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 77.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|