C22H37FIN5O2 — CID 111684317
1-[4-[[N-ethyl-N'-[2-(2-fluorophenoxy)propyl]carbamimidoyl]amino]butyl]piperidine-4-carboxamide;hydroiodide (PubChem CID 111684317) has the molecular formula C22H37FIN5O2 and a molecular weight of 549.47 g/mol. Its IUPAC name is 1-[4-[[N-ethyl-N'-[2-(2-fluorophenoxy)propyl]carbamimidoyl]amino]butyl]piperidine-4-carboxamide;hydroiodide.
| Compound Name | 1-[4-[[N-ethyl-N'-[2-(2-fluorophenoxy)propyl]carbamimidoyl]amino]butyl]piperidine-4-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111684317 |
| Molecular Formula | C22H37FIN5O2 |
| Molecular Weight | 549.47 g/mol |
| Exact Mass | 549.20 |
| IUPAC Name | 1-[4-[[N-ethyl-N'-[2-(2-fluorophenoxy)propyl]carbamimidoyl]amino]butyl]piperidine-4-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\CC(C)Oc1ccccc1F)NCCCCN1CCC(C(N)=O)CC1.I |
| InChI | InChI=1S/C22H36FN5O2.HI/c1-3-25-22(27-16-17(2)30-20-9-5-4-8-19(20)23)26-12-6-7-13-28-14-10-18(11-15-28)21(24)29;/h4-5,8-9,17-18H,3,6-7,10-16H2,1-2H3,(H2,24,29)(H2,25,26,27);1H |
| InChIKey | DFYBBCLDWUSLIW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.47 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|