C23H41N5O — CID 111687214
1-ethyl-3-[4-(4-ethylpiperazin-1-yl)butyl]-2-[2-(2-methylphenoxy)propyl]guanidine (PubChem CID 111687214) has the molecular formula C23H41N5O and a molecular weight of 403.62 g/mol. Its IUPAC name is 1-ethyl-3-[4-(4-ethylpiperazin-1-yl)butyl]-2-[2-(2-methylphenoxy)propyl]guanidine.
| Compound Name | 1-ethyl-3-[4-(4-ethylpiperazin-1-yl)butyl]-2-[2-(2-methylphenoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111687214 |
| Molecular Formula | C23H41N5O |
| Molecular Weight | 403.62 g/mol |
| Exact Mass | 403.33 |
| IUPAC Name | 1-ethyl-3-[4-(4-ethylpiperazin-1-yl)butyl]-2-[2-(2-methylphenoxy)propyl]guanidine |
| SMILES | CCN/C(=N\CC(C)Oc1ccccc1C)NCCCCN1CCN(CC)CC1 |
| InChI | InChI=1S/C23H41N5O/c1-5-24-23(26-19-21(4)29-22-12-8-7-11-20(22)3)25-13-9-10-14-28-17-15-27(6-2)16-18-28/h7-8,11-12,21H,5-6,9-10,13-19H2,1-4H3,(H2,24,25,26) |
| InChIKey | CZJJHBZMEOUAQN-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.62 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|