C19H35IN6 — CID 111205279
N'-(5,5-dimethylhexyl)-N-ethyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 111205279) has the molecular formula C19H35IN6 and a molecular weight of 474.44 g/mol. Its IUPAC name is N'-(5,5-dimethylhexyl)-N-ethyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-(5,5-dimethylhexyl)-N-ethyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111205279 |
| Molecular Formula | C19H35IN6 |
| Molecular Weight | 474.44 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | N'-(5,5-dimethylhexyl)-N-ethyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCCCC(C)(C)C)N1CCN(c2ncccn2)CC1.I |
| InChI | InChI=1S/C19H34N6.HI/c1-5-20-17(21-10-7-6-9-19(2,3)4)24-13-15-25(16-14-24)18-22-11-8-12-23-18;/h8,11-12H,5-7,9-10,13-16H2,1-4H3,(H,20,21);1H |
| InChIKey | QYANTKZMRJOILX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|