C16H28N6O3S — CID 111512394
N-ethyl-N'-[2-(2-methylsulfonylethoxy)ethyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide (PubChem CID 111512394) has the molecular formula C16H28N6O3S and a molecular weight of 384.51 g/mol. Its IUPAC name is N-ethyl-N'-[2-(2-methylsulfonylethoxy)ethyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[2-(2-methylsulfonylethoxy)ethyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111512394 |
| Molecular Formula | C16H28N6O3S |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | N-ethyl-N'-[2-(2-methylsulfonylethoxy)ethyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCOCCS(C)(=O)=O)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C16H28N6O3S/c1-3-17-15(20-7-12-25-13-14-26(2,23)24)21-8-10-22(11-9-21)16-18-5-4-6-19-16/h4-6H,3,7-14H2,1-2H3,(H,17,20) |
| InChIKey | HQLAEGSZNYJRNP-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|