C19H32IN3O4S — CID 109426117
N-ethyl-N'-[2-(2-methylsulfonylethoxy)ethyl]-4-phenoxypiperidine-1-carboximidamide;hydroiodide (PubChem CID 109426117) has the molecular formula C19H32IN3O4S and a molecular weight of 525.45 g/mol. Its IUPAC name is N-ethyl-N'-[2-(2-methylsulfonylethoxy)ethyl]-4-phenoxypiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[2-(2-methylsulfonylethoxy)ethyl]-4-phenoxypiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109426117 |
| Molecular Formula | C19H32IN3O4S |
| Molecular Weight | 525.45 g/mol |
| Exact Mass | 525.12 |
| IUPAC Name | N-ethyl-N'-[2-(2-methylsulfonylethoxy)ethyl]-4-phenoxypiperidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCOCCS(C)(=O)=O)N1CCC(Oc2ccccc2)CC1.I |
| InChI | InChI=1S/C19H31N3O4S.HI/c1-3-20-19(21-11-14-25-15-16-27(2,23)24)22-12-9-18(10-13-22)26-17-7-5-4-6-8-17;/h4-8,18H,3,9-16H2,1-2H3,(H,20,21);1H |
| InChIKey | BIPQIYRVHMETDO-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.45 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|