C12H26IN3O3S — CID 111493049
N-ethyl-N'-[2-(2-methylsulfonylethoxy)ethyl]pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111493049) has the molecular formula C12H26IN3O3S and a molecular weight of 419.33 g/mol. Its IUPAC name is N-ethyl-N'-[2-(2-methylsulfonylethoxy)ethyl]pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[2-(2-methylsulfonylethoxy)ethyl]pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111493049 |
| Molecular Formula | C12H26IN3O3S |
| Molecular Weight | 419.33 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | N-ethyl-N'-[2-(2-methylsulfonylethoxy)ethyl]pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCOCCS(C)(=O)=O)N1CCCC1.I |
| InChI | InChI=1S/C12H25N3O3S.HI/c1-3-13-12(15-7-4-5-8-15)14-6-9-18-10-11-19(2,16)17;/h3-11H2,1-2H3,(H,13,14);1H |
| InChIKey | SKBDGWOCVNGUBN-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.33 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|