C20H29N7O2S — CID 111205568
N'-[2-(benzylsulfamoyl)ethyl]-N-ethyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide (PubChem CID 111205568) has the molecular formula C20H29N7O2S and a molecular weight of 431.57 g/mol. Its IUPAC name is N'-[2-(benzylsulfamoyl)ethyl]-N-ethyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N'-[2-(benzylsulfamoyl)ethyl]-N-ethyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111205568 |
| Molecular Formula | C20H29N7O2S |
| Molecular Weight | 431.57 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | N'-[2-(benzylsulfamoyl)ethyl]-N-ethyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCS(=O)(=O)NCc1ccccc1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C20H29N7O2S/c1-2-21-19(26-12-14-27(15-13-26)20-22-9-6-10-23-20)24-11-16-30(28,29)25-17-18-7-4-3-5-8-18/h3-10,25H,2,11-17H2,1H3,(H,21,24) |
| InChIKey | HIKZANZYTCOOHQ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 102.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.57 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|