C21H29N5O4S — CID 111167881
N'-[2-(benzylsulfamoyl)ethyl]-N-ethyl-4-(furan-2-carbonyl)piperazine-1-carboximidamide (PubChem CID 111167881) has the molecular formula C21H29N5O4S and a molecular weight of 447.56 g/mol. Its IUPAC name is N'-[2-(benzylsulfamoyl)ethyl]-N-ethyl-4-(furan-2-carbonyl)piperazine-1-carboximidamide.
| Compound Name | N'-[2-(benzylsulfamoyl)ethyl]-N-ethyl-4-(furan-2-carbonyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111167881 |
| Molecular Formula | C21H29N5O4S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | N'-[2-(benzylsulfamoyl)ethyl]-N-ethyl-4-(furan-2-carbonyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCS(=O)(=O)NCc1ccccc1)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C21H29N5O4S/c1-2-22-21(23-10-16-31(28,29)24-17-18-7-4-3-5-8-18)26-13-11-25(12-14-26)20(27)19-9-6-15-30-19/h3-9,15,24H,2,10-14,16-17H2,1H3,(H,22,23) |
| InChIKey | ZZYSTOAFSKFVEM-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 107.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|