C16H27N5O4S — CID 111166415
N-ethyl-N'-[2-(ethylsulfonylamino)ethyl]-4-(furan-2-carbonyl)piperazine-1-carboximidamide (PubChem CID 111166415) has the molecular formula C16H27N5O4S and a molecular weight of 385.49 g/mol. Its IUPAC name is N-ethyl-N'-[2-(ethylsulfonylamino)ethyl]-4-(furan-2-carbonyl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[2-(ethylsulfonylamino)ethyl]-4-(furan-2-carbonyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111166415 |
| Molecular Formula | C16H27N5O4S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | N-ethyl-N'-[2-(ethylsulfonylamino)ethyl]-4-(furan-2-carbonyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCNS(=O)(=O)CC)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C16H27N5O4S/c1-3-17-16(18-7-8-19-26(23,24)4-2)21-11-9-20(10-12-21)15(22)14-6-5-13-25-14/h5-6,13,19H,3-4,7-12H2,1-2H3,(H,17,18) |
| InChIKey | NZQLAFXFNVFTRS-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 107.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|