C20H32N4O2S — CID 109442287
N'-[2-(benzylsulfamoyl)ethyl]-N-ethyl-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide (PubChem CID 109442287) has the molecular formula C20H32N4O2S and a molecular weight of 392.57 g/mol. Its IUPAC name is N'-[2-(benzylsulfamoyl)ethyl]-N-ethyl-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide.
| Compound Name | N'-[2-(benzylsulfamoyl)ethyl]-N-ethyl-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide |
|---|---|
| PubChem CID | 109442287 |
| Molecular Formula | C20H32N4O2S |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | N'-[2-(benzylsulfamoyl)ethyl]-N-ethyl-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide |
| SMILES | CCN/C(=N\CCS(=O)(=O)NCc1ccccc1)N1CC2CCCCC2C1 |
| InChI | InChI=1S/C20H32N4O2S/c1-2-21-20(24-15-18-10-6-7-11-19(18)16-24)22-12-13-27(25,26)23-14-17-8-4-3-5-9-17/h3-5,8-9,18-19,23H,2,6-7,10-16H2,1H3,(H,21,22) |
| InChIKey | YVJKYMFIFCZHHT-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|